ਪਿਗਮੈਂਟ ਪੀਲੇ 151-ਕੋਰਿਮੈਕਸ ਯੈਲੋ ਐਚ 4 ਜੀ
ਪਿਗਮੈਂਟ ਪੀਲੇ 151 ਦੇ ਤਕਨੀਕੀ ਮਾਪਦੰਡ
| ਰੰਗ ਇੰਡੈਕਸ ਨੰ. | ਪਿਗਮੈਂਟ ਪੀਲਾ 151 |
| ਉਤਪਾਦ ਦਾ ਨਾਮ | ਕੋਰਿਮੈਕਸ ਯੈਲੋ ਐਚ 4 ਜੀ |
| ਉਤਪਾਦ ਸ਼੍ਰੇਣੀ | ਜੈਵਿਕ ਪਿਗਮੈਂਟ |
| ਸੀਏਐਸ ਨੰਬਰ | 31837-42-0 |
| ਈਯੂ ਨੰਬਰ | 250-830-4 |
| ਰਸਾਇਣਕ ਪਰਿਵਾਰ | ਮੋਨੋ ਅਜ਼ੋ |
| ਅਣੂ ਭਾਰ | 381.34 |
| ਅਣੂ ਫਾਰਮੂਲਾ | C18H15N5O5 |
| ਪੀਐਚ ਮੁੱਲ | 7 |
| ਘਣਤਾ | 1.6 |
| ਤੇਲ ਸੋਖਣਾ (ਮਿ.ਲੀ. / 100 ਗ੍ਰਾਮ)% | 45 |
| ਹਲਕਾ ਤੇਜ (ਪਰਤ) | 6-7 |
| ਗਰਮੀ ਪ੍ਰਤੀਰੋਧ (ਪਰਤ) | 200 |
| ਲਾਈਟ ਫਾਸਨੇਸ (ਪਲਾਸਟਿਕ) | 7-8 |
| ਗਰਮੀ ਪ੍ਰਤੀਰੋਧ (ਪਲਾਸਟਿਕ) | 260 |
| ਪਾਣੀ ਪ੍ਰਤੀਰੋਧ | 5 |
| ਤੇਲ ਦਾ ਵਿਰੋਧ | 5 |
| ਐਸਿਡ ਵਿਰੋਧ | 5 |
| ਖਾਰੀ ਵਿਰੋਧ | 5 |
ਰੰਗ | ![]() |
| ਹਯੂ ਡਿਸਟਰੀਬਿ .ਸ਼ਨ |
ਅਣੂ ਬਣਤਰ:

ਐਪਲੀਕੇਸ਼ਨ :
ਆਟੋਮੋਟਿਵ ਪੇਂਟ, ਆਰਕੀਟੈਕਚਰਲ ਕੋਟਿੰਗਸ, ਕੋਇਲ ਕੋਟਿੰਗਜ਼, ਉਦਯੋਗਿਕ ਪੇਂਟ, ਪਾ powderਡਰ ਕੋਟਿੰਗਸ, ਪ੍ਰਿੰਟਿੰਗ ਪੇਸਟ, ਪੀਵੀਸੀ, ਰਬੜ, ਪੀਐਸ, ਪੀਪੀ, ਪੀਈ, ਪੀਯੂ, ਪਾਣੀ ਅਧਾਰਤ ਸਿਆਹੀਆਂ, ਘੋਲਨਸ਼ੀਲ ਸਿਆਹੀਆਂ, ਯੂਵੀ ਸਿਆਹੀਆਂ ਲਈ ਸਿਫਾਰਸ਼ ਕੀਤੀ ਜਾਂਦੀ ਹੈ.
ਆਫਸੈੱਟ ਸਿਆਹੀਆਂ ਵਿੱਚ ਇਸਤੇਮਾਲ ਕੀਤਾ ਜਾ ਸਕਦਾ ਹੈ.
ਸੰਬੰਧਿਤ ਜਾਣਕਾਰੀ
ਪਿਗਮੈਂਟ ਪੀਲਾ 151 ਇੱਕ ਰੰਗ ਦਿੰਦਾ ਹੈ ਜੋ ਸੀਆਈ ਪਿਗਮੈਂਟ ਪੀਲੇ 154 ਨਾਲੋਂ ਹਰੇ ਅਤੇ ਪਿਗਮੈਂਟ ਯੈਲੋ 175 ਨਾਲੋਂ ਲਾਲ ਹੈ. ਹਯੁਅਲ ਕੋਣ 97.4 ਡਿਗਰੀ (1 / 3SD) ਹੈ. ਹੋਸਟਪੇਰਮ ਯੈਲੋ ਐਚ 4 ਜੀ ਦਾ ਖਾਸ ਸਤ੍ਹਾ ਖੇਤਰ 23 ਮੀ2 / ਜੀ, ਜਿਸ ਵਿਚ ਚੰਗੀ ਓਹਲੇ ਕਰਨ ਦੀ ਸ਼ਕਤੀ ਹੈ. ਕਠੋਰਤਾ ਸ਼ਾਨਦਾਰ ਹੈ. ਅਲਕੀਡ ਟ੍ਰਾਈਨਿਟ੍ਰਿਲ ਰਾਲ ਦਾ ਰੰਗਣ ਦਾ ਨਮੂਨਾ ਫਲੋਰੀਡਾ ਵਿਚ 1 ਸਾਲ ਲਈ ਸਾਹਮਣੇ ਆਇਆ ਹੈ. ਮੌਸਮ ਦੀ ਤੇਜ਼ੀ ਨਾਲ ਇੱਕ ਗ੍ਰੇਡ 5 ਸਲੇਟੀ ਕਾਰਡ ਹੁੰਦਾ ਹੈ, ਅਤੇ ਪਤਲਾ ਰੰਗ (1; 3TiO2) ਅਜੇ ਵੀ ਗਰੇਡ 4 ਹੈ; 1/3 ਸਟੈਂਡਰਡ ਡੂੰਘਾਈ ਵਿਚ ਐਚਡੀਪੀਈ ਦੀ ਗਰਮੀ ਪ੍ਰਤੀਰੋਧਤਾ ਸਥਿਰਤਾ 260 ° C / 5min ਹੈ; ਇਹ ਉੱਚੇ ਅੰਤ ਦੇ ਉਦਯੋਗਿਕ ਕੋਟਿੰਗਾਂ, ਆਟੋਮੋਟਿਵ ਪ੍ਰਾਈਮਰਾਂ (ਓ.ਐੱਮ.) ਲਈ isੁਕਵਾਂ ਹੈ, ਅਤੇ ਫੈਥੋਲੋਸਾਈਨਾਈਨਜ਼ ਅਤੇ ਅਕਾਰਜੀਨ ਰੰਗਾਂ ਦੇ ਨਾਲ ਜੋੜਿਆ ਜਾ ਸਕਦਾ ਹੈ, ਅਤੇ ਪੋਲੀਸਟਰ ਲਮਨੀਟੇਡ ਪਲਾਸਟਿਕ ਫਿਲਮਾਂ ਦੇ ਸਿਆਹੀ ਰੰਗ ਨੂੰ ਵੀ ਪ੍ਰਿੰਟ ਕਰਨ ਲਈ ਵਰਤਿਆ ਜਾ ਸਕਦਾ ਹੈ.
aliases:13980; Benzoic acid, 2-(2-(1-(((2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)amino)carbonyl)-2-oxopropyl)diazenyl)-; pigment yellow 151; 2-[[1-[[(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)amino]carbonyl]-2-oxopropyl]azo]benzoic acid; C.I. 13980; fast yellow h4g; 2-[2-OXO-1-[(2-OXO-1,3-DIHYDROBENZOIMIDAZOL-5-YL)CARBAMOY; PROPYL]DIAZENYLBENZOIC ACID; Benzoic acid, 2-1-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)aminocarbonyl-2-oxopropylazo-; BENZIMIDAZOLONE YELLOS H4G; Benzimidazolone Yellow H4G(Pigment Yellow 151); 2-[(E)-{1,3-dioxo-1-[(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)amino]butan-2-yl}diazenyl]benzoic acid; 2-[2-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamoyl]propyl]azobenzoic acid.
IUPAC Name: 2-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]benzoic acid
InChI : InChI=1S/C18H15N5O5/c1-9(24)15(23-22-12-5-3-2-4-11(12)17(26)27)16(25)19-10-6-7-13-14(8-10)21-18(28)20-13/h2-8,15H,1H3,(H,19,25)(H,26,27)(H2,20,21,28)
InChIKey: YMFWVWDPPIWORA-UHFFFAOYSA-N
Canonical SMILES: CC(=O)C(C(=O)NC1=CC2=C(C=C1)NC(=O)N2)N=NC3=CC=CC=C3C(=O)O
Chemical and Physical Properties
Computed Properties
| Property Name | Property Value |
| ਅਣੂ ਭਾਰ | 381.3 g/mol |
| XLogP3-AA | 1.7 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 6 |
| Exact Mass | 381.10731860 g/mol |
| Monoisotopic Mass | 381.10731860 g/mol |
| Topological Polar Surface Area | 149Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 681 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Handling and storage:
Handling
Advice on protection against fire and explosion
Keep away from sources of ignition
Avoid formation of dust
Take precautionary measures against electrostatic loading
Storage
Be kept in a ventilated, cool and dry place, it should be also avoided to contact with acid material and expose to air. Keep container dry
ਵੀਡੀਓ:











